CAS 1181457-87-3

Acetamide, 2-[(3-pyridinylmethyl)amino]-, hydrochloride (1:1)

Description:

Acetamide, 2-[(3-pyridinylmethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a pyridine ring, which contributes to its biological activity. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. This compound typically exhibits properties such as moderate to high polarity due to the amide and pyridine functionalities, which can influence its interaction with biological systems. It may also display basic characteristics due to the nitrogen atom in the pyridine ring. The compound is likely to be stable under standard conditions but may require specific storage conditions to maintain its integrity. Its structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or other disorders, given the presence of the pyridine moiety, which is often associated with bioactive compounds. As with any chemical, safety data and handling precautions should be observed.

Formula: C₈H₁₁N₃O·ClH

InChI: InChI=1S/C8H11N3O.ClH/c9-8(12)6-11-5-7-2-1-3-10-4-7;/h1-4,11H,5-6H2,(H2,9,12);1H

InChI key: InChIKey=LQJZDPLJRBPOLH-UHFFFAOYSA-N

SMILES: C(NCC(N)=O)C=1C=CC=NC1.Cl

Synonyms:

• Acetamide, 2-[(3-pyridinylmethyl)amino]-, hydrochloride (1:1)