CAS 1181457-91-9

Morpholine, 2,6-dimethyl-4-(4-piperidinyl)-, hydrochloride (1:2)

Description:

Morpholine, 2,6-dimethyl-4-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its morpholine and piperidine moieties, which contribute to its unique properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. Morpholine derivatives are known for their applications in pharmaceuticals, particularly as intermediates in the synthesis of various bioactive compounds. The specific structure of this compound suggests potential biological activity, possibly influencing central nervous system functions or serving as a precursor in drug development. Safety data should be consulted for handling and exposure risks, as morpholine derivatives can exhibit toxicity and irritant properties. Overall, this compound represents a significant interest in medicinal chemistry and related fields.

Formula: C₁₁H₂₂N₂O·2ClH

InChI: InChI=1S/C11H22N2O.2ClH/c1-9-7-13(8-10(2)14-9)11-3-5-12-6-4-11;;/h9-12H,3-8H2,1-2H3;2*1H

InChI key: InChIKey=QAECYNOAAVFDNH-UHFFFAOYSA-N

SMILES: CC1CN(CC(C)O1)C2CCNCC2.Cl

Synonyms:

• Morpholine, 2,6-dimethyl-4-(4-piperidinyl)-, hydrochloride (1:2)

2,6-Dimethyl-4-(piperidin-4-yl)morpholine dihydrochloride

CAS: 1181457-91-9

Versatile small molecule scaffold

Formula: C₁₁H₂₄Cl₂N₂O

Purity: Min. 95%

Molecular weight: 271.22 g/mol

Ref: 3D-GXB45791