CAS 1181458-01-4

2(1H)-Isoquinolineethanamine, 3,4-dihydro-6,7-dimethoxy-, hydrochloride (1:2)

Description:

2(1H)-Isoquinolineethanamine, 3,4-dihydro-6,7-dimethoxy-, hydrochloride (1:2) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. This specific compound is a derivative of isoquinoline with additional methoxy groups at the 6 and 7 positions, contributing to its unique properties. The presence of the ethanamine side chain indicates that it has amine functionality, which can participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is studied.

Formula: C₁₃H₂₀N₂O₂·2ClH

InChI: InChI=1S/C13H20N2O2.2ClH/c1-16-12-7-10-3-5-15(6-4-14)9-11(10)8-13(12)17-2;;/h7-8H,3-6,9,14H2,1-2H3;2*1H

InChI key: InChIKey=DYKYIIASHFHFNL-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(=CC1OC)CCN(CCN)C2.Cl

Synonyms:

• 2(1H)-Isoquinolineethanamine, 3,4-dihydro-6,7-dimethoxy-, hydrochloride (1:2)