CAS 1181458-03-6

Cycloheptanamine, 1-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

Description:

Cycloheptanamine, 1-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and a trifluoromethyl-substituted oxadiazole moiety. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The hydrochloride salt form indicates that the compound is likely to be a solid at room temperature and is soluble in water, which can enhance its bioavailability. The trifluoromethyl group is known to influence the lipophilicity and metabolic stability of compounds, potentially affecting their interaction with biological targets. This compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific safety and handling information, as well as detailed biological activity, would require further investigation and research.

Formula: C₁₀H₁₄F₃N₃O·ClH

InChI: InChI=1S/C10H14F3N3O.ClH/c11-10(12,13)8-15-7(16-17-8)9(14)5-3-1-2-4-6-9;/h1-6,14H2;1H

InChI key: InChIKey=DNLHFKLLMOCERK-UHFFFAOYSA-N

SMILES: NC1(CCCCCC1)C=2N=C(C(F)(F)F)ON2.Cl

Synonyms:

• Cycloheptanamine, 1-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)