CAS 1181458-12-7

2-Cyclopropyl-9-methyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one

Description:

2-Cyclopropyl-9-methyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one is a heterocyclic compound characterized by its complex structure, which includes a quinazolinone core fused with a triazole ring. This compound features a cyclopropyl group and a methyl group, contributing to its unique chemical properties and potential biological activity. The presence of the triazole moiety often indicates potential pharmacological applications, as triazoles are known for their role in various therapeutic agents. The compound's molecular structure suggests it may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the specific arrangement of functional groups can influence its solubility, stability, and reactivity, which are critical factors in drug development. Overall, 2-Cyclopropyl-9-methyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one represents a class of compounds that may hold promise in the field of pharmaceuticals, particularly in the development of new therapeutic agents.

Formula: C₁₃H₁₂N₄O

InChI: InChI=1S/C13H12N4O/c1-7-2-5-10-9(6-7)12-15-11(8-3-4-8)16-17(12)13(18)14-10/h2,5-6,8H,3-4H2,1H3,(H,14,18)

InChI key: InChIKey=DHXMWASJGSWNRP-UHFFFAOYSA-N

SMILES: O=C1N2C(C=3C(N1)=CC=C(C)C3)=NC(=N2)C4CC4

Synonyms:

• 2-Cyclopropyl-9-methyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
• [1,2,4]Triazolo[1,5-c]quinazolin-5(6H)-one, 2-cyclopropyl-9-methyl-

2-Cyclopropyl-9-methyl-5H,6H-[1,2,4]triazolo[1,5-c]quinazolin-5-one

CAS: 1181458-12-7

Versatile small molecule scaffold

Formula: C₁₃H₁₂N₄O

Purity: Min. 95%

Molecular weight: 240.26 g/mol

Ref: 3D-GXB45812