CymitQuimica logo

CAS 1181458-31-0

:

3-Azabicyclo[4.1.0]heptane-1-carboxylic acid, hydrochloride (1:1)

Description:
3-Azabicyclo[4.1.0]heptane-1-carboxylic acid, hydrochloride (1:1), is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom integrated into a bicyclic system. This compound features a carboxylic acid functional group, contributing to its acidic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the azabicyclic structure may impart interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the stereochemistry of the bicyclic framework, which may affect its binding affinity to biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Azabicyclo[4.1.0]heptane-1-carboxylic acid, hydrochloride, represents a significant class of compounds with potential applications in drug development and other chemical research fields.
Formula:C7H11NO2·ClH
InChI:InChI=1S/C7H11NO2.ClH/c9-6(10)7-3-5(7)1-2-8-4-7;/h5,8H,1-4H2,(H,9,10);1H
InChI key:InChIKey=FMPBLESGLOIVEL-UHFFFAOYSA-N
SMILES:C(O)(=O)C12C(C1)CCNC2.Cl
Synonyms:
  • 3-Azabicyclo[4.1.0]heptane-1-carboxylic acid hydrochloride
  • 3-Azabicyclo[4.1.0]heptane-1-carboxylic acid, hydrochloride (1:1)
Found 3 products.