CymitQuimica logo

CAS 1181458-36-5

:

Acetamide, 2-amino-N-(4-bromophenyl)-, hydrochloride (1:1)

Description:
Acetamide, 2-amino-N-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features a 4-bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential basicity, which can influence its reactivity and interaction with other chemical species. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for hydrogen bonding, which can affect its melting point and solubility. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H9BrN2O·ClH
InChI:InChI=1S/C8H9BrN2O.ClH/c9-6-1-3-7(4-2-6)11-8(12)5-10;/h1-4H,5,10H2,(H,11,12);1H
InChI key:InChIKey=RSRMNANEVNSSPD-UHFFFAOYSA-N
SMILES:N(C(CN)=O)C1=CC=C(Br)C=C1.Cl
Synonyms:
  • Acetamide, 2-amino-N-(4-bromophenyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.