CAS 1181458-40-1

2-Furanmethanamine, tetrahydro-α-phenyl-, hydrochloride (1:1)

Description:

2-Furanmethanamine, tetrahydro-α-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its furan and amine functional groups, which contribute to its reactivity and potential biological activity. The presence of the tetrahydro-α-phenyl moiety suggests that it may exhibit properties typical of amines, such as basicity and the ability to form salts, as indicated by its hydrochloride form. This compound is likely to be a white or off-white solid, soluble in water due to the hydrochloride salt formation, which enhances its solubility compared to the free base. Its structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the furan ring may impart unique electronic properties, influencing its reactivity and potential applications. As with many amines, it may also participate in hydrogen bonding, affecting its behavior in different environments. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₅NO·ClH

InChI: InChI=1S/C11H15NO.ClH/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9;/h1-3,5-6,10-11H,4,7-8,12H2;1H

InChI key: InChIKey=NCVGEMHNPJKBLJ-UHFFFAOYSA-N

SMILES: C(N)(C1CCCO1)C2=CC=CC=C2.Cl

Synonyms:

• 2-Furanmethanamine, tetrahydro-α-phenyl-, hydrochloride (1:1)
• (Oxolan-2-yl)(phenyl)methanamine hydrochloride