CAS 1181458-48-9
:2-(2,4,5,6-Tetrahydro-3-cyclopentapyrazolyl)benzenamine
Description:
2-(2,4,5,6-Tetrahydro-3-cyclopentapyrazolyl)benzenamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with an amine group and a tetrahydro-cyclopentapyrazole moiety. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the cyclopentapyrazole structure may impart unique pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stereochemistry and functional groups can affect its interaction with biological targets, potentially leading to specific biological activities. Its CAS number, 1181458-48-9, allows for precise identification and retrieval of information regarding its synthesis, safety data, and applications in research. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential implications in drug development and material science.
Formula:C12H13N3
InChI:InChI=1S/C12H13N3/c13-10-6-2-1-4-8(10)12-9-5-3-7-11(9)14-15-12/h1-2,4,6H,3,5,7,13H2,(H,14,15)
InChI key:InChIKey=AXEHEHULZXWCAH-UHFFFAOYSA-N
SMILES:NC1=C(C2=C3C(=NN2)CCC3)C=CC=C1
Synonyms:- Benzenamine, 2-(2,4,5,6-tetrahydro-3-cyclopentapyrazolyl)-
- 2-(2,4,5,6-Tetrahydro-3-cyclopentapyrazolyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.