CAS 1181458-49-0

Benzenemethanamine, 4-(1H-imidazol-1-ylmethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-(1H-imidazol-1-ylmethyl)-, hydrochloride (1:1), commonly referred to as a specific type of substituted benzylamine, is characterized by its structural features that include a benzene ring, an amine group, and an imidazole moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The imidazole group contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. The presence of the amine group allows for hydrogen bonding, which can influence its interaction with biological targets. Additionally, the compound's hydrochloride form indicates that it can exist as a stable salt, which is often advantageous for formulation in medicinal chemistry. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₃N₃·ClH

InChI: InChI=1S/C11H13N3.ClH/c12-7-10-1-3-11(4-2-10)8-14-6-5-13-9-14;/h1-6,9H,7-8,12H2;1H

InChI key: InChIKey=RCKPTHOOSBOAOO-UHFFFAOYSA-N

SMILES: C(C1=CC=C(CN)C=C1)N2C=CN=C2.Cl

Synonyms:

• Benzenemethanamine, 4-(1H-imidazol-1-ylmethyl)-, hydrochloride (1:1)