CAS 1181458-52-5

1H-Pyrazole-1-ethanamine, α,3,5-trimethyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-ethanamine, α,3,5-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an ethanamine side chain, contributing to its amine properties. The presence of three methyl groups at the α, 3, and 5 positions of the pyrazole ring enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its CAS number, 1181458-52-5, uniquely identifies it in chemical databases, facilitating the search for related literature and safety data. Overall, this compound's structural features suggest potential utility in drug development and other chemical applications.

Formula: C₈H₁₅N₃·ClH

InChI: InChI=1S/C8H15N3.ClH/c1-6(9)5-11-8(3)4-7(2)10-11;/h4,6H,5,9H2,1-3H3;1H

InChI key: InChIKey=IJXMKEXVDJUERZ-UHFFFAOYSA-N

SMILES: C(C(C)N)N1N=C(C)C=C1C.Cl

Synonyms:

• 1H-Pyrazole-1-ethanamine, α,3,5-trimethyl-, hydrochloride (1:1)