
CAS 1181458-54-7
:1H-Indazol-4-amine, 1-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-, hydrochloride (1:2)
Description:
1H-Indazol-4-amine, 1-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The presence of the amine functional group indicates potential basicity and reactivity in various chemical environments. The compound features a tert-butyl group, which contributes to its hydrophobic characteristics and may influence its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on its molecular structure and the presence of functional groups, which can affect its binding affinity and activity in biological systems. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and research.
Formula:C11H19N3·2ClH
InChI:InChI=1S/C11H19N3.2ClH/c1-11(2,3)14-10-6-4-5-9(12)8(10)7-13-14;;/h7,9H,4-6,12H2,1-3H3;2*1H
InChI key:InChIKey=KFMFLEHVESYGNV-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C2=C(C=N1)C(N)CCC2.Cl
Synonyms:- 1H-Indazol-4-amine, 1-(1,1-dimethylethyl)-4,5,6,7-tetrahydro-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.