
CAS 1181458-56-9
:Hydrazine, (1-cyclopropylethyl)-, hydrochloride (1:2)
Description:
Hydrazine, (1-cyclopropylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine backbone, which is a nitrogen-rich organic compound known for its reducing properties. The presence of the cyclopropyl group contributes to its unique structural and electronic properties, potentially influencing its reactivity and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and chemical synthesis. The compound may exhibit properties typical of hydrazines, such as being a strong reducing agent and having potential applications in rocket propellants and as a precursor in organic synthesis. Safety considerations are paramount, as hydrazines are known to be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, this compound's characteristics make it of interest in both industrial and research settings, although specific applications would depend on its reactivity and the context of use.
Formula:C5H12N2·2ClH
InChI:InChI=1S/C5H12N2.2ClH/c1-4(7-6)5-2-3-5;;/h4-5,7H,2-3,6H2,1H3;2*1H
InChI key:InChIKey=IXGUHPAFLMFSEU-UHFFFAOYSA-N
SMILES:C(NN)(C)C1CC1.Cl
Synonyms:- Hydrazine, (1-cyclopropylethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.