
CAS 1181458-64-9
:2-Thiazolamine, 5-[(2-fluorophenyl)methyl]-4-methyl-, hydrobromide (1:1)
Description:
2-Thiazolamine, 5-[(2-fluorophenyl)methyl]-4-methyl-, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. The presence of a fluorophenyl group indicates that the compound has a phenyl ring substituted with a fluorine atom, contributing to its potential biological activity and lipophilicity. The hydrobromide salt form suggests that the compound is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions, stability, and reactivity can be influenced by the functional groups present, such as the thiazole and the fluorophenyl moiety. As with many thiazole derivatives, it may have applications in drug development, particularly in targeting specific biological pathways or diseases. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C11H11FN2S·BrH
InChI:InChI=1S/C11H11FN2S.BrH/c1-7-10(15-11(13)14-7)6-8-4-2-3-5-9(8)12;/h2-5H,6H2,1H3,(H2,13,14);1H
InChI key:InChIKey=ZXZIUULSPOULOG-UHFFFAOYSA-N
SMILES:C(C=1SC(N)=NC1C)C2=C(F)C=CC=C2.Br
Synonyms:- 2-Thiazolamine, 5-[(2-fluorophenyl)methyl]-4-methyl-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.