
CAS 1181458-67-2
:3-Pyridinamine, 6-phenoxy-, hydrochloride (1:2)
Description:
3-Pyridinamine, 6-phenoxy-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) at the 3-position and a phenoxy group (-O-phenyl) at the 6-position of the pyridine ring. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the phenoxy group can influence the compound's biological activity and interaction with other molecules. As with many pyridine derivatives, this compound may exhibit properties such as antimicrobial, anti-inflammatory, or other pharmacological activities, depending on its specific structure and substituents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.
Formula:C11H10N2O·2ClH
InChI:InChI=1S/C11H10N2O.2ClH/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10;;/h1-8H,12H2;2*1H
InChI key:InChIKey=WZXICMOPVQECRE-UHFFFAOYSA-N
SMILES:O(C1=CC=C(N)C=N1)C2=CC=CC=C2.Cl
Synonyms:- 3-Pyridinamine, 6-phenoxy-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.