CAS 1181458-75-2

2-Azabicyclo[4.1.0]heptane-6-carboxylic acid, hydrochloride (1:1)

Description:

2-Azabicyclo[4.1.0]heptane-6-carboxylic acid, hydrochloride (1:1), with the CAS number 1181458-75-2, is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom incorporated into a bicyclic system. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile intermediate in organic synthesis. As a hydrochloride salt, it is usually more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the carboxylic acid group contributes to its acidity and potential reactivity, while the bicyclic structure may influence its conformational stability and interaction with biological targets. Additionally, this compound may exhibit specific stereochemical properties, which can affect its biological activity and pharmacokinetics. Overall, 2-Azabicyclo[4.1.0]heptane-6-carboxylic acid, hydrochloride is of interest in medicinal chemistry and related fields due to its structural characteristics and potential applications.

Formula: C₇H₁₁NO₂·ClH

InChI: InChI=1S/C7H11NO2.ClH/c9-6(10)7-2-1-3-8-5(7)4-7;/h5,8H,1-4H2,(H,9,10);1H

InChI key: InChIKey=RZZZILSGIYWRHX-UHFFFAOYSA-N

SMILES: C(O)(=O)C12C(C1)NCCC2.Cl

Synonyms:

• 2-Azabicyclo[4.1.0]heptane-6-carboxylic acid, hydrochloride (1:1)