CAS 1181458-81-0

Quinoline, 7-chloro-1,2,3,4-tetrahydro-8-methyl-, hydrochloride (1:1)

Description:

Quinoline, 7-chloro-1,2,3,4-tetrahydro-8-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 7-position and a methyl group at the 8-position contributes to its unique properties and reactivity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential interactions with biological targets, and it may be investigated for its therapeutic applications. Additionally, the tetrahydro configuration indicates that it has undergone partial hydrogenation, which can influence its chemical reactivity and stability. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₀H₁₂ClN·ClH

InChI: InChI=1S/C10H12ClN.ClH/c1-7-9(11)5-4-8-3-2-6-12-10(7)8;/h4-5,12H,2-3,6H2,1H3;1H

InChI key: InChIKey=NVGRGRJMRAQWKJ-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC=C1Cl)CCCN2.Cl

Synonyms:

• Quinoline, 7-chloro-1,2,3,4-tetrahydro-8-methyl-, hydrochloride (1:1)