CymitQuimica logo

CAS 1181458-82-1

:

1H-Imidazole-1-ethanamine, 2-(1-methylethyl)-, hydrochloride (1:2)

Description:
1H-Imidazole-1-ethanamine, 2-(1-methylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which contributes to its basicity and potential biological activity. The presence of the ethylamine side chain enhances its solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit properties such as acting as a ligand in coordination chemistry or serving as a precursor in the synthesis of more complex molecules. Its specific interactions and reactivity can be influenced by the imidazole moiety, which is known for participating in hydrogen bonding and coordination with metal ions. The compound's safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards. Overall, its unique structural features position it as a compound of interest in medicinal chemistry and related fields.
Formula:C8H15N3·2ClH
InChI:InChI=1S/C8H15N3.2ClH/c1-7(2)8-10-4-6-11(8)5-3-9;;/h4,6-7H,3,5,9H2,1-2H3;2*1H
InChI key:InChIKey=AQZYCAGFXOAHIG-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N(CCN)C=CN1.Cl
Synonyms:
  • 1H-Imidazole-1-ethanamine, 2-(1-methylethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.