CAS 1181458-84-3: Acetamide, 2-amino-N-(2-furanylmethyl)-, hydrochloride (1:1)

Description: Acetamide, 2-amino-N-(2-furanylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. The presence of the furan ring indicates that it has a heterocyclic structure, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in biological systems. This compound may exhibit biological activity due to the amino group, which can participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. Its molecular structure suggests potential uses in pharmaceuticals, particularly in drug design, where the furan moiety can influence pharmacokinetics and pharmacodynamics. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, acetamide derivatives like this one are of interest in medicinal chemistry for their potential therapeutic applications.

Formula: C₇H₁₀N₂O₂·ClH

InChI: InChI=1S/C7H10N2O2.ClH/c8-4-7(10)9-5-6-2-1-3-11-6;/h1-3H,4-5,8H2,(H,9,10);1H

InChI key: InChIKey=FOTSWFVQWMCZAX-UHFFFAOYSA-N

SMILES: Cl.O=C(NCC=1OC=CC1)CN

Synonyms:

• Acetamide, 2-amino-N-(2-furanylmethyl)-, hydrochloride (1:1)

2-amino-N-(furan-2-ylmethyl)acetamide hydrochloride

CAS: 1181458-84-3

• Purity: 95.0%
• Molecular weight: 190.6300048828125

2-Amino-N-(2-furylmethyl)acetamide hydrochloride

CAS: 1181458-84-3

Versatile small molecule scaffold

• Formula: C₇H₁₁ClN₂O₂
• Purity: Min. 95%
• Molecular weight: 190.63 g/mol