CAS 1181458-85-4

Carbamimidothioic acid, N-cyclopentyl-, dodecyl ester, hydrobromide (1:1)

Description:

Carbamimidothioic acid, N-cyclopentyl-, dodecyl ester, hydrobromide (1:1) is a chemical compound characterized by its unique structure, which includes a carbamimidothioic acid moiety and a dodecyl ester linked to a cyclopentyl group. This compound typically exhibits properties associated with both amine and thioester functionalities, which may influence its reactivity and solubility in various solvents. The presence of the hydrobromide indicates that it exists as a salt, which can enhance its stability and solubility in polar solvents. The dodecyl chain contributes to its hydrophobic characteristics, potentially making it useful in applications requiring surfactant properties or as a lipid-soluble agent. Additionally, the cyclopentyl group may impart specific steric and electronic effects, influencing the compound's biological activity and interaction with other molecules. Overall, this compound's unique combination of functional groups suggests potential utility in pharmaceutical or agrochemical applications, although specific biological or chemical activities would require further investigation.

Formula: C₁₈H₃₆N₂S·BrH

InChI: InChI=1S/C18H36N2S.BrH/c1-2-3-4-5-6-7-8-9-10-13-16-21-18(19)20-17-14-11-12-15-17;/h17H,2-16H2,1H3,(H2,19,20);1H

InChI key: InChIKey=PJEIDKSQDXDWGF-UHFFFAOYSA-N

SMILES: N(C(SCCCCCCCCCCCC)=N)C1CCCC1.Br

Synonyms:

• Carbamimidothioic acid, N-cyclopentyl-, dodecyl ester, hydrobromide (1:1)