CymitQuimica logo

CAS 1181458-94-5

:

Propanamide, 3-amino-N-(1-methylpropyl)-, hydrochloride (1:1)

Description:
Propanamide, 3-amino-N-(1-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. This substance features an amino group attached to the propanamide backbone, indicating potential basic properties. The presence of the 1-methylpropyl group suggests that it has branched alkyl characteristics, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The hydrochloride form often stabilizes the compound and can improve its bioavailability. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the molecular interactions and the presence of functional groups. Safety data and handling precautions should be consulted due to potential toxicity or reactivity associated with amides and amino compounds.
Formula:C7H16N2O·ClH
InChI:InChI=1S/C7H16N2O.ClH/c1-3-6(2)9-7(10)4-5-8;/h6H,3-5,8H2,1-2H3,(H,9,10);1H
InChI key:InChIKey=DVCMCTCDNXRXFM-UHFFFAOYSA-N
SMILES:N(C(CCN)=O)C(CC)C.Cl
Synonyms:
  • Propanamide, 3-amino-N-(1-methylpropyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.