CAS 1181458-95-6

1H-Imidazole-1-propanamine, β,2-dimethyl-, hydrochloride (1:1)

Description:

1H-Imidazole-1-propanamine, β,2-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a propanamine side chain with two methyl groups at the β and 2 positions, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the imidazole moiety suggests potential biological activity, as imidazole derivatives are often found in biologically active compounds and can interact with biological targets. The compound may exhibit basic properties due to the amine group, allowing it to participate in protonation reactions. Its structural characteristics may also influence its stability, reactivity, and interaction with other molecules, making it of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation and empirical data.

Formula: C₈H₁₅N₃·ClH

InChI: InChI=1S/C8H15N3.ClH/c1-7(5-9)6-11-4-3-10-8(11)2;/h3-4,7H,5-6,9H2,1-2H3;1H

InChI key: InChIKey=HRLMNXQQODVVRJ-UHFFFAOYSA-N

SMILES: C(C(CN)C)N1C(C)=NC=C1.Cl

Synonyms:

• 1H-Imidazole-1-propanamine, β,2-dimethyl-, hydrochloride (1:1)