CAS 1181459-01-7

4-Thiomorpholineethanimidamide, N-hydroxy-, hydrochloride (1:2)

Description:

4-Thiomorpholineethanimidamide, N-hydroxy-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a thiomorpholine ring and an amidine functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments. The presence of the N-hydroxy group suggests potential reactivity, particularly in biological systems, where it may participate in various biochemical processes. The thiomorpholine moiety contributes to the compound's potential pharmacological properties, as thiomorpholines are often associated with diverse biological activities. The hydrochloride form indicates that the compound is likely to be a stable, crystalline solid under standard conditions, making it suitable for laboratory handling and formulation. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₆H₁₃N₃OS·2ClH

InChI: InChI=1S/C6H13N3OS.2ClH/c7-6(8-10)5-9-1-3-11-4-2-9;;/h10H,1-5H2,(H2,7,8);2*1H

InChI key: InChIKey=PGJMXXBFPQSAAV-UHFFFAOYSA-N

SMILES: C(C(NO)=N)N1CCSCC1.Cl

Synonyms:

• 4-Thiomorpholineethanimidamide, N-hydroxy-, hydrochloride (1:2)