CAS 1181459-03-9

Ethyl 2-cyano-3-[[4-(difluoromethoxy)phenyl]amino]-2-propenoate

Description:

Ethyl 2-cyano-3-[[4-(difluoromethoxy)phenyl]amino]-2-propenoate, identified by its CAS number 1181459-03-9, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyano group, an ethyl ester, and a difluoromethoxy-substituted phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the cyano and propenoate functional groups. It may participate in various chemical reactions, including nucleophilic additions and substitutions, making it of interest in medicinal chemistry and material science. The difluoromethoxy group can influence its electronic properties and lipophilicity, potentially affecting its biological activity and interactions. As with many synthetic compounds, safety data and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Overall, this compound represents a class of molecules that can be explored for various applications, including pharmaceuticals and agrochemicals.

Formula: C₁₃H₁₂F₂N₂O₃

InChI: InChI=1S/C13H12F2N2O3/c1-2-19-12(18)9(7-16)8-17-10-3-5-11(6-4-10)20-13(14)15/h3-6,8,13,17H,2H2,1H3

InChI key: InChIKey=LMOXYQZLDSIJAC-UHFFFAOYSA-N

SMILES: N(C=C(C(OCC)=O)C#N)C1=CC=C(OC(F)F)C=C1

Synonyms:

• 2-Propenoic acid, 2-cyano-3-[[4-(difluoromethoxy)phenyl]amino]-, ethyl ester
• Ethyl 2-cyano-3-[[4-(difluoromethoxy)phenyl]amino]-2-propenoate