CAS 1181561-44-3
:2-Amino-N-cyclopropyl-N-[(2-methylphenyl)methyl]acetamide
Description:
2-Amino-N-cyclopropyl-N-[(2-methylphenyl)methyl]acetamide is a chemical compound characterized by its unique structure, which includes an acetamide functional group, an amino group, and a cyclopropyl ring. This compound features a cyclopropyl moiety, which contributes to its rigidity and potential for unique interactions in biological systems. The presence of the 2-methylphenyl group suggests that it may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The amino group can participate in hydrogen bonding, which may enhance its reactivity and potential as a pharmacophore in medicinal chemistry. This compound may be of interest in drug development due to its structural features that could interact with specific biological targets. Additionally, its molecular weight and specific stereochemistry could affect its pharmacokinetics and pharmacodynamics. Overall, 2-Amino-N-cyclopropyl-N-[(2-methylphenyl)methyl]acetamide represents a class of compounds that may have significant implications in therapeutic applications, although specific biological activities would require further investigation.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c1-10-4-2-3-5-11(10)9-15(12-6-7-12)13(16)8-14/h2-5,12H,6-9,14H2,1H3
InChI key:InChIKey=YWJYQDVZLYOGOA-UHFFFAOYSA-N
SMILES:N(CC1=C(C)C=CC=C1)(C(CN)=O)C2CC2
Synonyms:- Acetamide, 2-amino-N-cyclopropyl-N-[(2-methylphenyl)methyl]-
- 2-Amino-N-cyclopropyl-N-[(2-methylphenyl)methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.