CymitQuimica logo

CAS 118157-08-7

:

1-(4-Methylpentyl)piperazine

Description:
1-(4-Methylpentyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 4-methylpentyl substituent, contributing to its unique properties. It is typically classified as an organic amine and may exhibit psychoactive effects, making it of interest in pharmacological research. The presence of the piperazine ring allows for potential interactions with various neurotransmitter systems, which can influence its biological activity. In terms of physical properties, it is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound's solubility in water and organic solvents can vary, affecting its applications in different chemical environments. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, and appropriate handling precautions should be taken. Overall, 1-(4-Methylpentyl)piperazine is a compound of interest in both synthetic chemistry and pharmacology, warranting further investigation into its properties and potential applications.
Formula:C10H22N2
InChI:InChI=1S/C10H22N2/c1-10(2)4-3-7-12-8-5-11-6-9-12/h10-11H,3-9H2,1-2H3
InChI key:InChIKey=DNRRGRHYTDLXGN-UHFFFAOYSA-N
SMILES:C(CCC(C)C)N1CCNCC1
Synonyms:
  • 1-(4-Methylpentyl)piperazine
  • Piperazine, 1-(4-methylpentyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.