CAS 118157-94-1: 3,6-DIMETHYL-4-HYDROXYCOUMARIN
Description:3,6-Dimethyl-4-hydroxycoumarin is a synthetic organic compound belonging to the coumarin family, characterized by its aromatic structure and the presence of hydroxyl and methyl groups. This compound typically exhibits a pale yellow to white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticoagulant properties, making it of interest in pharmaceutical and cosmetic applications. The hydroxyl group contributes to its reactivity, allowing for various chemical modifications. Additionally, 3,6-dimethyl-4-hydroxycoumarin can be used as a fluorescent marker in biochemical assays. Safety data indicates that, while it may pose some risks, it is generally considered to have low toxicity when handled appropriately. As with any chemical substance, proper safety measures should be observed during handling and experimentation.
Formula:C11H10O3
InChI:InChI=1/C11H10O3/c1-6-3-4-9-8(5-6)10(12)7(2)11(13)14-9/h3-5,12H,1-2H3
- Synonyms:
- 4-Hydroxy-3,6-Dimethyl-Chromen-2-One
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3,6-Dimethyl-4-hydroxycoumarin REF: 54-OR351294CAS: 118157-94-1 | - - - | To inquire | Mon 21 Apr 25 |
![]() | 4-Hydroxy-3,6-dimethyl-2H-chromen-2-one REF: 3D-TEA15794CAS: 118157-94-1 | Min. 95% | To inquire | Thu 29 May 25 |
![]() | 4-Hydroxy-3,6-dimethyl-2h-chromen-2-one REF: 10-F671931CAS: 118157-94-1 | 98% | - - - | Discontinued product |

4-Hydroxy-3,6-dimethyl-2H-chromen-2-one
Ref: 3D-TEA15794
50mg | 735.00 € | ||
500mg | 2,013.00 € |

Ref: 10-F671931
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |