CymitQuimica logo

CAS 118158-94-4

:

3-[(Phenylmethyl)thio]-5-(2-thienyl)-4H-1,2,4-triazol-4-amine

Description:
3-[(Phenylmethyl)thio]-5-(2-thienyl)-4H-1,2,4-triazol-4-amine, with the CAS number 118158-94-4, is a chemical compound characterized by its unique structural features, including a triazole ring, a thiol group, and a phenylmethyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the thienyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its triazole moiety is known for its role in various pharmacological applications, including antifungal and anticancer activities. The compound's stability and reactivity can be influenced by the functional groups attached to the triazole ring, which may also affect its solubility and permeability. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals, where its potential applications can be explored.
Formula:C13H12N4S2
InChI:InChI=1S/C13H12N4S2/c14-17-12(11-7-4-8-18-11)15-16-13(17)19-9-10-5-2-1-3-6-10/h1-8H,9,14H2
InChI key:InChIKey=NBZFEWLUSUDAIH-UHFFFAOYSA-N
SMILES:NN1C(=NN=C1SCC2=CC=CC=C2)C3=CC=CS3
Synonyms:
  • 3-[(Phenylmethyl)thio]-5-(2-thienyl)-4H-1,2,4-triazol-4-amine
  • 4H-1,2,4-Triazol-4-amine, 3-[(phenylmethyl)thio]-5-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.