
CAS 1181600-71-4
:2-Methyl-1-[(4-pyridinylmethyl)amino]-2-propanol
Description:
2-Methyl-1-[(4-pyridinylmethyl)amino]-2-propanol, identified by its CAS number 1181600-71-4, is a chemical compound characterized by its unique structure that includes a tertiary alcohol and a pyridine moiety. This compound typically exhibits properties associated with both alcohols and amines, such as solubility in polar solvents like water and alcohols, and potential basicity due to the presence of the amino group. The pyridine ring contributes to its aromatic character, which can influence its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the context of drug design and development. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and pharmacodynamics. Overall, 2-Methyl-1-[(4-pyridinylmethyl)amino]-2-propanol represents a versatile structure that could be explored for various chemical and pharmaceutical applications.
Formula:C10H16N2O
InChI:InChI=1S/C10H16N2O/c1-10(2,13)8-12-7-9-3-5-11-6-4-9/h3-6,12-13H,7-8H2,1-2H3
InChI key:InChIKey=SNDTXMIGCZATTR-UHFFFAOYSA-N
SMILES:C(NCC(C)(C)O)C=1C=CN=CC1
Synonyms:- 2-Methyl-1-[(4-pyridinylmethyl)amino]-2-propanol
- 2-Propanol, 2-methyl-1-[(4-pyridinylmethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.