CAS 1181600-72-5

Methyl α-hydroxy-4-pyridinepropanoate

Description:

Methyl α-hydroxy-4-pyridinepropanoate, identified by its CAS number 1181600-72-5, is an organic compound characterized by its pyridine ring and a hydroxyl group adjacent to a carboxylate moiety. This compound typically exhibits properties associated with both pyridine derivatives and esters, including moderate polarity and potential solubility in polar organic solvents. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Methyl α-hydroxy-4-pyridinepropanoate may be of interest in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its structure allows for possible modifications that could enhance its efficacy or selectivity in biological systems. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, this compound represents a unique combination of functional groups that may contribute to its utility in synthetic chemistry and medicinal applications.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-13-9(12)8(11)6-7-2-4-10-5-3-7/h2-5,8,11H,6H2,1H3

InChI key: InChIKey=LNMQVURJHSDBLR-UHFFFAOYSA-N

SMILES: C(C(C(OC)=O)O)C=1C=CN=CC1

Synonyms:

• 4-Pyridinepropanoic acid, α-hydroxy-, methyl ester
• Methyl α-hydroxy-4-pyridinepropanoate