CymitQuimica logo

CAS 1181631-87-7

:

α-Hydroxy-2-methylbenzenepropanoic acid

Description:
α-Hydroxy-2-methylbenzenepropanoic acid, also known as a specific type of hydroxy acid, is characterized by its structural features that include a hydroxyl group (-OH) and a propanoic acid moiety attached to a methyl-substituted aromatic ring. This compound typically exhibits properties associated with both phenolic and carboxylic acids, such as solubility in polar solvents and potential for hydrogen bonding. The presence of the hydroxyl group contributes to its acidity, while the aromatic ring can influence its reactivity and stability. This compound may be of interest in various applications, including pharmaceuticals and cosmetics, due to its potential role in skin exfoliation and moisturizing. Additionally, its unique structure may impart specific biological activities, making it a subject of research in medicinal chemistry. As with many organic acids, it may also participate in various chemical reactions, such as esterification or amidation, depending on the functional groups present in its structure.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-5,9,11H,6H2,1H3,(H,12,13)
InChI key:InChIKey=YDTGEPLJNTZWKH-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)O)C1=C(C)C=CC=C1
Synonyms:
  • Benzenepropanoic acid, α-hydroxy-2-methyl-
  • α-Hydroxy-2-methylbenzenepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.