CAS 1181643-80-0

α-Hydroxy-4-pyridinepropanoic acid

Description:

α-Hydroxy-4-pyridinepropanoic acid, identified by its CAS number 1181643-80-0, is an organic compound characterized by the presence of both a hydroxyl group and a pyridine ring in its structure. This compound typically exhibits properties associated with both carboxylic acids and alcohols, including the ability to form hydrogen bonds, which can influence its solubility and reactivity. The pyridine moiety contributes to its aromatic characteristics and can affect its biological activity, making it of interest in pharmaceutical and biochemical research. The α-hydroxy group suggests potential applications in various chemical reactions, such as esterification or oxidation. Additionally, the compound may exhibit specific stereochemical configurations, which can influence its interactions in biological systems. Overall, α-Hydroxy-4-pyridinepropanoic acid is a versatile compound with potential applications in medicinal chemistry and related fields, warranting further investigation into its properties and uses.

Formula: C₈H₉NO₃

InChI: InChI=1S/C8H9NO3/c10-7(8(11)12)5-6-1-3-9-4-2-6/h1-4,7,10H,5H2,(H,11,12)

InChI key: InChIKey=WYHKHGURSPTCTH-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)O)C=1C=CN=CC1

Synonyms:

• α-Hydroxy-4-pyridinepropanoic acid
• 4-Pyridinepropanoic acid, α-hydroxy-