CAS 118178-79-3
:3-Hydroxy-1-(2-methoxyethyl)-2-methyl-4(1H)-pyridinone
Description:
3-Hydroxy-1-(2-methoxyethyl)-2-methyl-4(1H)-pyridinone, with the CAS number 118178-79-3, is an organic compound characterized by its pyridinone structure, which features a hydroxyl group and a methoxyethyl substituent. This compound typically exhibits properties associated with both pyridine and ketone functionalities, including potential solubility in polar solvents due to the presence of the hydroxyl and methoxy groups. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the methyl group contributes to its hydrophobic character, while the methoxyethyl group can enhance its lipophilicity and influence its interaction with biological targets. The compound's stability and reactivity can be influenced by the functional groups present, which may participate in hydrogen bonding or other intermolecular interactions. Overall, 3-Hydroxy-1-(2-methoxyethyl)-2-methyl-4(1H)-pyridinone represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C9H13NO3
InChI:InChI=1S/C9H13NO3/c1-7-9(12)8(11)3-4-10(7)5-6-13-2/h3-4,12H,5-6H2,1-2H3
InChI key:InChIKey=CBPRDGWDQCRPEW-UHFFFAOYSA-N
SMILES:C(COC)N1C(C)=C(O)C(=O)C=C1
Synonyms:- 3-Hydroxy-1-(2-methoxyethyl)-2-methyl-4(1H)-pyridinone
- CP 51
- 3-Hydroxy-1-(2-methoxyethyl)-2-methyl-1,4-dihydropyridin-4-one
- CP 51 (chelating agent)
- 4(1H)-Pyridinone, 3-hydroxy-1-(2-methoxyethyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
