
CAS 1181816-14-7
:1-(Hydroxymethyl)-3-(phenylmethoxy)cyclobutanecarbonitrile
Description:
1-(Hydroxymethyl)-3-(phenylmethoxy)cyclobutanecarbonitrile is a chemical compound characterized by its unique structure, which includes a cyclobutane ring, a hydroxymethyl group, and a phenylmethoxy substituent. The presence of the hydroxymethyl group indicates that the compound has a functional alcohol group, which can participate in hydrogen bonding, potentially influencing its solubility and reactivity. The phenylmethoxy group contributes to the compound's aromatic character, which may enhance its stability and affect its interactions with other molecules. Additionally, the carbonitrile functional group introduces a polar character to the molecule, which can play a significant role in its chemical behavior, including reactivity and potential applications in organic synthesis or medicinal chemistry. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, this compound's unique combination of functional groups makes it an interesting subject for further research in various chemical applications.
Formula:C13H15NO2
InChI:InChI=1S/C13H15NO2/c14-9-13(10-15)6-12(7-13)16-8-11-4-2-1-3-5-11/h1-5,12,15H,6-8,10H2
InChI key:InChIKey=DVMFHLBEGPBHHP-UHFFFAOYSA-N
SMILES:C(#N)C1(CO)CC(OCC2=CC=CC=C2)C1
Synonyms:- Cyclobutanecarbonitrile, 1-(hydroxymethyl)-3-(phenylmethoxy)-
- 3-Benzyloxy-1-hydroxymethyl-cyclobutanecarbonitrile
- 1-(Hydroxymethyl)-3-(phenylmethoxy)cyclobutanecarbonitrile
- 1-(Hydroxymethyl)-3-phenylmethoxycyclobutane-1-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.