
CAS 1181816-16-9
:1,1-Dimethylethyl 6-(phenylmethoxy)-2-azaspiro[3.3]heptane-2-carboxylate
Description:
1,1-Dimethylethyl 6-(phenylmethoxy)-2-azaspiro[3.3]heptane-2-carboxylate, identified by its CAS number 1181816-16-9, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in its framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the phenylmethoxy group suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions. The dimethyl substituents on the nitrogen atom enhance steric hindrance, which may influence the compound's biological activity and interaction with other molecules. Additionally, the spirocyclic nature of the compound may impart rigidity to its structure, potentially affecting its conformational dynamics. Overall, this compound may have applications in medicinal chemistry or materials science, although specific biological activities or industrial uses would require further investigation and characterization.
Formula:C18H25NO3
InChI:InChI=1S/C18H25NO3/c1-17(2,3)22-16(20)19-12-18(13-19)9-15(10-18)21-11-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3
InChI key:InChIKey=FZOPVLTXCLJRJV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(C1)CC(OCC3=CC=CC=C3)C2
Synonyms:- 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-(phenylmethoxy)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 6-(phenylmethoxy)-2-azaspiro[3.3]heptane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.