
CAS 1181825-45-5
:3-Chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Description:
3-Chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 3-position of the indole enhances its reactivity and potential applications in various chemical reactions, particularly in medicinal chemistry and organic synthesis. The compound also features a boron-containing moiety, specifically a dioxaborolane, which is known for its utility in cross-coupling reactions, such as Suzuki coupling, facilitating the formation of carbon-carbon bonds. The tetramethyl substitution on the boron compound contributes to its stability and steric hindrance, influencing its reactivity profile. Overall, this compound may exhibit interesting biological activities and serves as a valuable intermediate in the synthesis of more complex organic molecules. Its unique structural features make it a subject of interest in both academic research and industrial applications.
Formula:C14H17BClNO2
InChI:InChI=1S/C14H17BClNO2/c1-13(2)14(3,4)19-15(18-13)10-7-5-6-9-11(16)8-17-12(9)10/h5-8,17H,1-4H3
InChI key:InChIKey=KXEPMPAGDSJYRJ-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=C(C=CC2)B3OC(C)(C)C(C)(C)O3)NC1
Synonyms:- 1H-Indole, 3-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Chloro-7-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
- 3-Chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery