CAS 118184-64-8
:2-Cyclopropylbenzenemethanamine hydrochloride
Description:
2-Cyclopropylbenzenemethanamine hydrochloride, with the CAS number 118184-64-8, is a chemical compound characterized by its unique structure, which features a cyclopropyl group attached to a benzene ring, along with a methanamine functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. It is often studied in the context of medicinal chemistry due to its potential biological activity, particularly in relation to neurotransmitter systems. The presence of the cyclopropyl moiety may influence its pharmacological properties, including receptor binding and metabolic stability. As with many amines, it may exhibit basicity, allowing it to form salts with acids. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use. Overall, 2-Cyclopropylbenzenemethanamine hydrochloride represents a compound of interest in both synthetic and medicinal chemistry fields.
Formula:C10H14ClN
InChI:InChI=1/C10H13N.ClH/c11-7-9-3-1-2-4-10(9)8-5-6-8;/h1-4,8H,5-7,11H2;1H
SMILES:c1ccc(C2CC2)c(c1)CN.Cl
Synonyms:- 1-(2-Cyclopropylphenyl)methanamine
- Benzenemethanamine, 2-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.