CAS 118194-13-1
:Soyasaponin Ab
Description:
Soyasaponin Ab is a triterpenoid saponin derived from soybeans, specifically from the Glycine max species. It is characterized by its complex structure, which includes a hydrophobic aglycone and one or more sugar moieties, contributing to its amphiphilic nature. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in both nutritional and pharmaceutical research. Soyasaponin Ab is known for its ability to interact with cell membranes, which can influence membrane permeability and cellular signaling pathways. Additionally, it has been studied for its role in enhancing the bioavailability of certain nutrients and its potential effects on gut health. The compound is typically extracted from soybean seeds and can be analyzed using techniques such as high-performance liquid chromatography (HPLC) for purity and concentration assessment. Its safety profile and efficacy in various applications continue to be subjects of ongoing research, particularly in the context of functional foods and dietary supplements.
Formula:C67H104O33
InChI:InChI=1S/C67H104O33/c1-26(71)87-24-35-48(89-27(2)72)52(90-28(3)73)53(91-29(4)74)61(94-35)96-47-32(75)23-88-57(46(47)83)100-55-54(84)62(5,6)20-31-30-12-13-37-64(8)16-15-38(65(9,25-70)36(64)14-17-67(37,11)66(30,10)19-18-63(31,55)7)95-60-51(44(81)43(80)49(97-60)56(85)86)99-59-50(42(79)40(77)34(22-69)93-59)98-58-45(82)41(78)39(76)33(21-68)92-58/h12,31-55,57-61,68-70,75-84H,13-25H2,1-11H3,(H,85,86)/t31-,32-,33+,34+,35+,36+,37+,38-,39+,40-,41-,42-,43-,44-,45+,46+,47-,48+,49-,50+,51+,52-,53+,54-,55+,57-,58-,59-,60+,61-,63+,64-,65+,66+,67+/m0/s1
InChI key:InChIKey=YZNCIXVBVQRGQN-YUTHWCJWSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)[C@H](O[C@H]5[C@H](O)[C@@H](O[C@H]6[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O6)[C@@H](O)CO5)[C@H](O)C(C)(C)C4)[H])=CC[C@@]1([C@]7(C)[C@@](CC2)([C@](CO)(C)[C@@H](O[C@H]8[C@H](O[C@H]9[C@H](O[C@@H]%10O[C@H](CO)[C@@H](O)[C@H](O)[C@H]%10O)[C@@H](O)[C@@H](O)[C@@H](CO)O9)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O8)CC7)[H])[H]
Synonyms:- (3β,4β,21β,22β)-21,23-Dihydroxy-22-[[3-O-(2,3,4,6-tetra-O-acetyl-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl)-α-<smallcap>L</smallcap>-arabinopyranosyl]oxy]olean-12-en-3-yl O-β-<smallcap>D</smallcap>-glucopyranosyl-(1→2)-O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→2)-β-<smallcap>D</span>-glucopyranosiduronic acid
- Soyasaponin Ab
- SoyasaponinAb
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranosiduronic acid, (3β,4β,21β,22β)-21,23-dihydroxy-22-[[3-O-(2,3,4,6-tetra-O-acetyl-β-<smallcap>D</smallcap>-glucopyranosyl)-α-<smallcap>L</smallcap>-arabinopyranosyl]oxy]olean-12-en-3-yl O-β-<smallcap>D</smallcap>-glucopyranosyl-(1→2)-O-β-<smallcap>D</span>-galactopyranosyl-(1→2)-
- Acetylsoyasaponin A1
- (3β,4β,21β,22β)-21,23-Dihydroxy-22-[[3-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-α-L-arabinopyranosyl]oxy]olean-12-en-3-yl O-β-D-glucopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→2)-β-D-glucopyranosiduronic acid
- β-D-Glucopyranosiduronic acid, (3β,4β,21β,22β)-21,23-dihydroxy-22-[[3-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-α-L-arabinopyranosyl]oxy]olean-12-en-3-yl O-β-D-glucopyranosyl-(1→2)-O-β-D-galactopyranosyl-(1→2)-
- soyosaponin Ab
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Soyasaponin Ab
CAS:Soyasaponin Ab may represent a viable candidate for effective vaccine adjuvant, TLR4 receptor dependent pathway may be involved in immune stimulatory effects of soyasaponin Ab. Soyasaponin Ab has anti-inflammatory effects, it can inhibit colon shortening, myeloperoxidase activity, the expression of cyclooxygenase-2 (COX-2) and inducible nitric oxide synthase (iNOS), and activation of the transcription factor nuclear factor-κB (NF-κB); soyasaponin Ab (1, 2, 5, and 10 μM) can inhibit the production of NO (IC50 = 1.6 ± 0.1 uM) and prosta. Soyasaponin Aa and Ab can markedly inhibit adipocyte differentiation and expression of various adipogenic marker genes through the downregulation of the adipogenesis-related transcription factors PPARγ and C/EBPα in 3T3-L1 adipocytes. They also can prevent scopolamine-induced memory impairment in mice without the inhibition of acetylcholinesterase, exhibit memory-enhancing effects.Formula:C67H104O33Purity:95%~99%Color and Shape:PowderMolecular weight:1437.54Soyasaponin Ab
CAS:Soyasaponin Ab: a potential vaccine adjuvant via TLR4 pathway.Formula:C67H104O33Purity:98.27% - 99.79%Color and Shape:SolidMolecular weight:1437.52Soyasaponin Ab
CAS:Soyasaponin Ab is a natural product that has immunomodulatory effects on the immune system. It inhibits the production of TNF-α, which is an inflammatory cytokine. Soyasaponin Ab also has anti-inflammatory properties and can be used to treat bowel disease. The mechanism of action is not clear, but it may be due to inhibition of fatty acid synthesis in the liver or stimulation of antioxidative enzymes. This compound is structurally similar to nonsteroidal anti-inflammatory drugs (NSAIDs). Soyasaponin Ab has been shown to inhibit LPS-induced inflammatory response and reduce metabolic disorders in vitro.
Purity:Min. 98 Area-%Color and Shape:PowderRef: 3D-FS74366
Discontinued product




