CAS 118194-43-7
:3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-[2-[[1-(methoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]-, [3S-[2[R*(R*)],3R*]]-
Description:
3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-[2-[[1-(methoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]-, [3S-[2[R*(R*)],3R*]]- is a complex organic compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of a tetrahydroisoquinoline moiety indicates that it has a saturated ring structure, which can influence its biological activity and solubility. Additionally, the compound contains a methoxycarbonyl group and a phenylpropylamine side chain, suggesting potential interactions with biological targets, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the specific notation, suggests that it may exhibit chiral properties, which can affect its pharmacological profile. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a research chemical.
Formula:C24H28N2O5
InChI:InChI=1S/C24H28N2O5/c1-16(25-20(24(30)31-2)13-12-17-8-4-3-5-9-17)22(27)26-15-19-11-7-6-10-18(19)14-21(26)23(28)29/h3-11,16,20-21,25H,12-15H2,1-2H3,(H,28,29)/t16-,20-,21-/m0/s1
InChI key:InChIKey=IMIMRLHORUXOFC-NDXORKPFSA-N
SMILES:C([C@@H](N[C@@H](CCC1=CC=CC=C1)C(OC)=O)C)(=O)N2[C@H](C(O)=O)CC=3C(C2)=CC=CC3
Synonyms:- 3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-[2-[[1-(methoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]-, [3S-[2[R*(R*)],3R*]]-
- (S)-2-[(S)-N-[(S)-1-Carboxy-3-phenylpropyl]alanyl]-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid, 1-methyl ester
- Quinapril Methyl Ester
- Quinapril Impurity 17
- 3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-2-[2-[[1-(methoxycarbonyl)-3-phenylpropyl]amino]-1-oxopropyl]-, [3S-[2[R*(R*)],3R*]]- (9CI)
- Quinapril Methyl Ester Analog
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Quinapril Methyl Ester
CAS:Controlled ProductFormula:C24H28N2O5Color and Shape:NeatMolecular weight:424.49

