
CAS 1181970-86-4
:6-Ethoxy-3-quinolinamine
Description:
6-Ethoxy-3-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of an ethoxy group at the 6-position and an amino group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic quinoline core. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the functional groups present. The amino group can act as a base, allowing for protonation under acidic conditions, while the ethoxy group can influence the compound's reactivity and polarity. Additionally, 6-Ethoxy-3-quinolinamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies, including its pharmacokinetics and potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-2-14-10-3-4-11-8(6-10)5-9(12)7-13-11/h3-7H,2,12H2,1H3
InChI key:InChIKey=KAOIKWXFCFJXCF-UHFFFAOYSA-N
SMILES:O(CC)C1=CC2=C(C=C1)N=CC(N)=C2
Synonyms:- 3-Quinolinamine, 6-ethoxy-
- 6-Ethoxy-3-quinolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.