CAS 1182-68-9
:2-[(2E,6E,10E,14E,18E)-icosa-2,6,10,14,18-pentaen-1-yl]-3-methylnaphthalene-1,4-dione
Description:
The chemical substance known as 2-[(2E,6E,10E,14E,18E)-icosa-2,6,10,14,18-pentaen-1-yl]-3-methylnaphthalene-1,4-dione, with the CAS number 1182-68-9, is a complex organic compound characterized by its unique structure that includes a long polyunsaturated hydrocarbon chain and a naphthalene-derived moiety. This compound features multiple conjugated double bonds, which contribute to its potential reactivity and optical properties. The presence of the naphthalene ring system, along with the dione functional groups, suggests that it may exhibit interesting electronic characteristics, possibly making it useful in applications such as organic electronics or as a dye. Additionally, the long carbon chain may influence its solubility and interaction with biological systems. Overall, this compound's structural features indicate potential for various chemical behaviors, including stability under certain conditions and reactivity with other chemical species, making it a subject of interest in both synthetic and applied chemistry.
Formula:C31H38O2
InChI:InChI=1/C31H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-27-26(2)30(32)28-24-21-22-25-29(28)31(27)33/h3-4,7-8,11-12,15-16,19-22,24-25H,5-6,9-10,13-14,17-18,23H2,1-2H3/b4-3+,8-7+,12-11+,16-15+,20-19+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Menaquinone 5
CAS:<p>Menaquinone 5 is a type of vitamin K, which is synthesized by bacteria. It is considered a dietary supplement that can be found in some foods and supplements. Menaquinone 5 is also present in the human body, where it helps to maintain the supply of calcium necessary for healthy bones and teeth. The hydroxyl group on menaquinone 5 can be oxidized by bacterial enzymes to form menadione, which is a potent inhibitor of bacterial growth. Menadione has been shown to inhibit the production of all-trans retinoic acid (ATRA) in cells and stimulate the synthesis of RNA and DNA in cell culture studies. Menaquinone 5 has also been shown to have an inhibitory effect on bacteria that produce subtilisin, such as Staphylococcus aureus, Bacillus subtilis, and Escherichia coli.</p>Formula:C36H48O2Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:512.77 g/mol


