CymitQuimica logo

CAS 118214-04-3

:

L-Mannose, 6-deoxy-, homopolymer

Description:
L-Mannose, 6-deoxy-, homopolymer, identified by the CAS number 118214-04-3, is a polysaccharide composed primarily of L-mannose units linked together through glycosidic bonds. This polymer exhibits characteristics typical of carbohydrates, including solubility in water and the ability to form gels or viscous solutions depending on concentration and environmental conditions. L-Mannose itself is a naturally occurring sugar that plays a crucial role in various biological processes, including cell recognition and signaling. The homopolymeric structure suggests that it consists solely of L-mannose residues, which can influence its physical properties, such as viscosity and molecular weight. Additionally, this substance may have applications in pharmaceuticals, food science, and biotechnology, particularly due to its potential prebiotic effects and ability to modulate immune responses. Its stability and reactivity can be affected by factors such as pH, temperature, and the presence of other chemical species, making it important to consider these conditions in practical applications.
Formula:(C6H12O5)x
InChI:InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5-,6-/m0/s1
InChI key:InChIKey=PNNNRSAQSRJVSB-BXKVDMCESA-N
SMILES:[C@@H]([C@H]([C@H](C)O)O)([C@H](C=O)O)O
Synonyms:
  • L-Mannose, 6-deoxy-, homopolymer
  • L-Rhamnose homopolymer
  • Polyrhamnose
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.