CAS 1182284-42-9

[1,1′-Biphenyl]-4-sulfonic acid, 3′-methoxy-, sodium salt (1:1)

Description:

[1,1′-Biphenyl]-4-sulfonic acid, 3′-methoxy-, sodium salt (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a sulfonic acid group (-SO3H) indicates its acidic nature, while the methoxy group (-OCH3) contributes to its solubility and reactivity. As a sodium salt, it is typically more soluble in water compared to its acid form, enhancing its utility in various applications. This compound is often used in organic synthesis, as a reagent in chemical reactions, and may serve as a surfactant or dispersant in industrial processes. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific formulation and purity. Additionally, the presence of functional groups suggests potential applications in pharmaceuticals, dyes, or as an intermediate in the synthesis of other chemical compounds. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.

Formula: C₁₃H₁₂O₄S·Na

InChI: InChI=1S/C13H12O4S.Na/c1-17-12-4-2-3-11(9-12)10-5-7-13(8-6-10)18(14,15)16;/h2-9H,1H3,(H,14,15,16);

InChI key: InChIKey=AXGOCIGICLIENJ-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1)C2=CC=C(S(=O)(=O)O)C=C2.[Na]

Synonyms:

• [1,1′-Biphenyl]-4-sulfonic acid, 3′-methoxy-, sodium salt (1:1)