CAS 118233-09-3
:N-(5-CHLORO-2-METHYL-4-NITROPHENYL)-BENZENESULFONAMIDE
Description:
N-(5-Chloro-2-methyl-4-nitrophenyl)-benzenesulfonamide, with the CAS number 118233-09-3, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a chlorinated aromatic ring and a nitro group, contributing to its potential biological activity. The presence of the sulfonamide moiety suggests that it may exhibit properties similar to other sulfonamide drugs, which are often used in medicinal chemistry. The compound's structure indicates it may have applications in pharmaceuticals, particularly in the development of antimicrobial agents. Its solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings, which may affect its interaction with biological targets. Additionally, the chlorine and nitro groups can enhance its lipophilicity and electronic properties, potentially influencing its pharmacokinetics and pharmacodynamics. Overall, this compound represents a class of sulfonamides that could be of interest in drug discovery and development.
Formula:C13H11ClN2O4S
InChI:InChI=1/C13H11ClN2O4S/c1-9-7-13(16(17)18)11(14)8-12(9)15-21(19,20)10-5-3-2-4-6-10/h2-8,15H,1H3
SMILES:Cc1cc(c(cc1NS(=O)(=O)c1ccccc1)Cl)N(=O)=O
Synonyms:- benzenesulfonamide, N-(5-chloro-2-methyl-4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.