CAS 1182346-30-0

5-Bromo-2-chloro-3-methylthiophene

Description:

5-Bromo-2-chloro-3-methylthiophene is a heterocyclic organic compound characterized by its thiophene ring, which contains both bromine and chlorine substituents, as well as a methylthio group. The presence of these halogen atoms and the methylthio group contributes to its unique chemical reactivity and physical properties. Typically, compounds like this exhibit moderate to high stability under standard conditions, but they can participate in various electrophilic substitution reactions due to the electron-withdrawing nature of the halogens. The compound may also exhibit interesting electronic properties, making it potentially useful in organic electronics or as a building block in the synthesis of more complex molecules. Its solubility in organic solvents and relatively low volatility are common traits for similar thiophene derivatives. Additionally, the presence of multiple functional groups can influence its behavior in biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₅H₄BrClS

InChI: InChI=1S/C5H4BrClS/c1-3-2-4(6)8-5(3)7/h2H,1H3

InChI key: InChIKey=ZIYVDVOOMMUCTO-UHFFFAOYSA-N

SMILES: CC1=C(Cl)SC(Br)=C1

Synonyms:

• Thiophene, 5-bromo-2-chloro-3-methyl-
• 5-Bromo-2-chloro-3-methylthiophene