CAS 1182367-47-0
:2-Chloro-4-[[(1R,2S)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]-2-hydroxypropyl]amino]-3-methylbenzonitrile
Description:
2-Chloro-4-[[(1R,2S)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]-2-hydroxypropyl]amino]-3-methylbenzonitrile is a complex organic compound characterized by its multi-functional structure, which includes a chloro group, a benzonitrile moiety, and an oxadiazole ring. The presence of the chloro substituent indicates potential reactivity and influence on the compound's electronic properties. The oxadiazole ring contributes to its heterocyclic nature, which can enhance biological activity and solubility. The compound also features a hydroxyl group, which can participate in hydrogen bonding, potentially affecting its interactions in biological systems. Its stereochemistry, indicated by the (1R,2S) configuration, suggests specific spatial arrangements that may influence its pharmacological properties. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, including solubility, stability, and biological activity.
Formula:C20H16ClN5O2
InChI:InChI=1S/C20H16ClN5O2/c1-11-16(8-7-15(10-23)17(11)21)24-18(12(2)27)20-26-25-19(28-20)14-5-3-13(9-22)4-6-14/h3-8,12,18,24,27H,1-2H3/t12-,18+/m0/s1
InChI key:InChIKey=XMBUPPIEVAFYHO-KPZWWZAWSA-N
SMILES:[C@@H](NC1=C(C)C(Cl)=C(C#N)C=C1)([C@H](C)O)C=2OC(=NN2)C3=CC=C(C#N)C=C3
Synonyms:- Vosilasarm
- 2-Chloro-4-[[(1R,2S)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]-2-hydroxypropyl]amino]-3-methylbenzonitrile
- RAD 140
- Benzonitrile, 2-chloro-4-[[(1R,2S)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]-2-hydroxypropyl]amino]-3-methyl-
- Testolone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Vosilasarm
CAS:RAD140 is an investigational selective androgen receptor modulator (SARM) for the treatment of conditions such as muscle wasting and breast cancer.Formula:C20H16ClN5O2Purity:99.01% - 99.6%Color and Shape:A Crystalline SolidMolecular weight:393.82RAD 140
CAS:Applications RAD 140 is a potent, orally bio-available, and non-steroidal selective androgen receptor modulator (SARM).
References Miller, C.P., et al.: ACS Med. Chem. Lett., 2, 124-129 (2011)Formula:C20H16ClN5O2Color and Shape:NeatMolecular weight:393.8RAD 140
CAS:Controlled ProductRAD 140 is a selective androgen receptor modulator (SARM), which is a type of synthetic compound designed to mimic the effects of anabolic steroids with reduced androgenic properties. Originating from pharmaceutical research, RAD 140 is engineered to selectively target androgen receptors in muscle and bone tissues, minimizing unwanted effects on other organs, such as the liver and prostate.
Formula:C20H16ClN5O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:393.83 g/molRef: 3D-FR159306
Discontinued product



