CAS 118248-91-2
:Fodipir
Description:
Fodipir, also known by its chemical name, is a compound primarily used in medical imaging, particularly in magnetic resonance imaging (MRI) as a contrast agent. It enhances the visibility of certain tissues and blood vessels, aiding in the diagnosis of various conditions. The substance is characterized by its ability to chelate metal ions, which contributes to its effectiveness in imaging applications. Fodipir is typically administered intravenously and is known for its relatively low toxicity profile, making it suitable for use in patients. Its mechanism of action involves the alteration of the magnetic properties of nearby water protons, thereby improving the contrast of the images obtained during MRI scans. Additionally, Fodipir has been studied for its potential neuroprotective effects, although its primary application remains in diagnostic imaging. As with any pharmaceutical agent, the use of Fodipir is subject to regulatory approval and guidelines to ensure patient safety and efficacy in clinical settings.
Formula:C22H32N4O14P2
InChI:InChI=1/C22H32N4O14P2/c1-13-21(31)17(15(5-23-13)11-39-41(33,34)35)7-25(9-19(27)28)3-4-26(10-20(29)30)8-18-16(12-40-42(36,37)38)6-24-14(2)22(18)32/h5-6,31-32H,3-4,7-12H2,1-2H3,(H,27,28)(H,29,30)(H2,33,34,35)(H2,36,37,38)
SMILES:Cc1c(c(CN(CCN(Cc2c(cnc(C)c2O)COP(=O)(O)O)CC(=O)O)CC(=O)O)c(cn1)COP(=O)(O)O)O
Synonyms:- Fodipir [USAN]
- Dpdp
- Excipient
- N,N'-1,2-Ethanediylbis(N-((3-hydroxy-2-methyl-5-((phosphonooxy)methyl)-4-pyridinyl)methyl)glycin)
- N,N'-1,2-Ethanediylbis(N-((3-hydroxy-2-methyl-5-((phosphonooxy)methyl)-4-pyridinyl)methyl)glycine)
- N,N'-Ethylenebis(N-((3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridyl)methyl)glycine) 5,5'-bis(dihydrogen phosphate)
- Glycine, N,N'-1,2-ethanediylbis(N-((3-hydroxy-2-methyl-5-((phosphonooxy)methyl)-4-pyridinyl)methyl)-
- N,N'-Ethylenebis(N-((3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridyl)methyl)glycine) 5,5'-bis(dihydrogenphosphate)
- 2,2'-{Ethane-1,2-Diylbis[({3-Hydroxy-2-Methyl-5-[(Phosphonooxy)Methyl]Pyridin-4-Yl}Methyl)Imino]}Diacetic Acid (Non-Preferred Name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fodipir
CAS:Controlled ProductApplications Fodipir is a research reagent which along with dephosphorylated derivative Dipyridoxyl Ethyldiamine are involved in Mangafodipir-mediated cytoprotection against 7β-Hydroxycholesterol-Induced cell death.
References Laskar, A., et al.: Pharmacology, 92, 182 (2013)Formula:C22H32N4O14P2Color and Shape:NeatMolecular weight:638.455Fodipir
CAS:Fodipir is a chelating agent that is used for the treatment of metastatic colorectal cancer. Fodipir has been shown to bind to cisplatin, a chemotherapy drug, and prevent it from binding to tissues or cells. This prevents the toxicity of cisplatin on tissues, such as the heart and liver. Fodipir also protects against platinum-based chemotherapy by preventing cell lysis and DNA damage in the myocardium. Fodipir may be useful in diagnosing conditions that require imaging because it is not absorbed by the body, allowing for clear images without interference from other molecules.Formula:C22H32N4O14P2Purity:Min. 95%Molecular weight:638.5 g/molFodipir
CAS:Fodipir, the active metabolite of mangafodipir, plays a crucial role in the mechanism of mangafodipir-mediated cytoprotection, specifically mitigating cellFormula:C22H32N4O14P2Purity:98%Color and Shape:SolidMolecular weight:638.46


