CAS 118249-08-4

1-(2-(3-iodo-4-azidophenyl)ethyl)-4-(3-(trifluoromethyl)phenyl)piperazine

Description:

1-(2-(3-iodo-4-azidophenyl)ethyl)-4-(3-(trifluoromethyl)phenyl)piperazine, with CAS number 118249-08-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperazine ring substituted with various functional groups. The presence of an azide group (-N3) and an iodine atom contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The trifluoromethyl group (-CF3) enhances lipophilicity, which can influence the compound's biological activity and pharmacokinetics. This compound may exhibit interesting properties such as selective binding to certain receptors or enzymes, making it a candidate for further research in drug discovery. Additionally, the presence of halogen atoms can affect the compound's stability and solubility in different solvents. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical and biological applications, warranting further investigation into its properties and effects.

Formula: C₁₉H₁₉F₃IN₅

InChI: InChI=1/C19H19F3IN5/c20-19(21,22)15-2-1-3-16(13-15)28-10-8-27(9-11-28)7-6-14-4-5-18(25-26-24)17(23)12-14/h1-5,12-13H,6-11H2

SMILES: c1cc(cc(c1)N1CCN(CCc2ccc(c(c2)I)N=[N+]=[NH-])CC1)C(F)(F)F

Synonyms:

• Azido-ipapp
• Piperazine, 1-(2-(4-azido-3-iodophenyl)ethyl)-4-(3-(trifluoromethyl)phenyl)-
• 1-[2-(4-Azido-3-Iodophenyl)Ethyl]-4-[3-(Trifluoromethyl)Phenyl]Piperazine
• 1-(2-(3-Iodo-4-azidophenyl)ethyl)-4-(3-(trifluoromethyl)phenyl)piperazine