CAS 118263-97-1

1-Methyl-2,4-piperidinedione

Description:

1-Methyl-2,4-piperidinedione, also known as N-methyl-2,4-piperidinedione, is a cyclic organic compound characterized by a piperidine ring with two carbonyl groups at the 2 and 4 positions and a methyl group at the nitrogen atom. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the carbonyl groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and cycloadditions. Its molecular structure imparts certain polar characteristics, influencing its solubility in polar solvents. Additionally, 1-Methyl-2,4-piperidinedione may exhibit biological activity, making it of interest in pharmacological research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₆H₉NO₂

InChI: InChI=1S/C6H9NO2/c1-7-3-2-5(8)4-6(7)9/h2-4H2,1H3

InChI key: InChIKey=FLHLLNQXQGRGBP-UHFFFAOYSA-N

SMILES: O=C1N(C)CCC(=O)C1

Synonyms:

• 1-Methyl-2,4-piperidinedione
• 2,4-Piperidinedione, 1-methyl-

1-METHYLPIPERIDINE-2,4-DIONE

CAS: 118263-97-1

Formula: C₆H₉NO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 127.143

Ref: 10-F503231

1-Methylpiperidine-2,4-dione

CAS: 118263-97-1

1-Methylpiperidine-2,4-dione is a biologically active molecule with anti-inflammatory and analgesic properties. It is synthesized by reacting a ketone with an amine to form a 1,3-diketone. The carbonyl group of the diketone reacts with an aldehyde to form an enamine, which can be reduced to yield the desired product. This reaction can be carried out either intramolecularly or intermolecularly. Reduction reactions are used in organic chemistry as they are often easier than oxidation reactions for carbonyl compounds.

Formula: C₆H₉NO₂

Purity: Min. 95%

Molecular weight: 127.14 g/mol

Ref: 3D-TEA26397

2,4-Piperidinedione, 1-methyl-

CAS: 118263-97-1

Formula: C₆H₉NO₂

Purity: ≥97%

Color and Shape: Solid

Molecular weight: 127.1412

Ref: IN-DA000ILS