CAS 118264-04-3
:6-Phenylazaperhydroine-2,4-dione
Description:
6-Phenylazaperhydroine-2,4-dione, identified by its CAS number 118264-04-3, is a chemical compound that features a unique bicyclic structure, incorporating both azabicyclic and diketone functionalities. This compound is characterized by the presence of a phenyl group attached to a nitrogen atom within a saturated ring system, which contributes to its stability and reactivity. The diketone functional groups (2,4-dione) suggest that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of the azabicyclic framework may also impart interesting properties such as potential biological activity, making it a subject of interest in medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the environment in which it is studied. Overall, 6-Phenylazaperhydroine-2,4-dione represents a versatile structure with potential applications in organic synthesis and pharmacology.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c13-9-6-10(12-11(14)7-9)8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,12,14)
SMILES:c1ccc(cc1)C1CC(=O)CC(=N1)O
Synonyms:- 2,4-Piperidinedione, 6-phenyl-
- 6-Phenylpiperidine-2,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Phenylazaperhydroine-2,4-dione
CAS:Formula:C11H11NO2Purity:97%Color and Shape:SolidMolecular weight:189.21056-Phenylazaperhydroine-2,4-dione
CAS:6-Phenylazaperhydroine-2,4-dionePurity:95%Molecular weight:189.21g/mol6-Phenylpiperidine-2,4-dione
CAS:Formula:C11H11NO2Purity:>97%Color and Shape:SolidMolecular weight:189.2146-Phenylazaperhydroine-2,4-dione
CAS:6-Phenylazaperhydroine-2,4-dione is an analog of azaperhydroine-2,4-dione that is synthesised by the addition of a phenyl group to the alpha carbon. This compound has been shown to inhibit the growth of mycobacteria in vitro and in vivo. It also shows high antimycobacterial activity against strains of Mycobacterium tuberculosis and Mycobacterium avium complex. 6-Phenylazaperhydroine-2,4-dione inhibits mycobacterial DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division. The compound is also enantiopure and optically pure, with a dieckmann geometry. 6-PhenylFormula:C11H11NO2Purity:Min. 95%Molecular weight:189.21 g/mol



